C22H31N5O3S — CID 52509283
(3S,6S)-N-butyl-1-[2-[[4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-6-methylpiperidine-3-carboxamide (PubChem CID 52509283) has the molecular formula C22H31N5O3S and a molecular weight of 445.59 g/mol. Its IUPAC name is (3S,6S)-N-butyl-1-[2-[[4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-6-methylpiperidine-3-carboxamide.
| Compound Name | (3S,6S)-N-butyl-1-[2-[[4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 52509283 |
| Molecular Formula | C22H31N5O3S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | (3S,6S)-N-butyl-1-[2-[[4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-6-methylpiperidine-3-carboxamide |
| SMILES | CCCCNC(=O)[C@H]1CC[C@H](C)N(C(=O)CSc2nncn2-c2ccc(OC)cc2)C1 |
| InChI | InChI=1S/C22H31N5O3S/c1-4-5-12-23-21(29)17-7-6-16(2)26(13-17)20(28)14-31-22-25-24-15-27(22)18-8-10-19(30-3)11-9-18/h8-11,15-17H,4-7,12-14H2,1-3H3,(H,23,29)/t16-,17-/m0/s1 |
| InChIKey | PKOZUROUEBNCHX-IRXDYDNUSA-N |
| XLogP | 2.91 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|