About 6-methyl-2,4-diphenyl-1,4-dihydropyrimidine
6-methyl-2,4-diphenyl-1,4-dihydropyrimidine (PubChem CID 5251039) has the molecular formula C17H16N2
and a molecular weight of 248.33 g/mol. Its IUPAC name is 6-methyl-2,4-diphenyl-1,4-dihydropyrimidine.
Molecular Properties
| Compound Name | 6-methyl-2,4-diphenyl-1,4-dihydropyrimidine |
| PubChem CID | 5251039 |
| Molecular Formula | C17H16N2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 6-methyl-2,4-diphenyl-1,4-dihydropyrimidine |
| SMILES | CC1=CC(c2ccccc2)N=C(c2ccccc2)N1 |
| InChI | InChI=1S/C17H16N2/c1-13-12-16(14-8-4-2-5-9-14)19-17(18-13)15-10-6-3-7-11-15/h2-12,16H,1H3,(H,18,19) |
| InChIKey | OVCSIQFHOSJUDA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-2,4-diphenyl-1,4-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2,4-diphenyl-1,4-dihydropyrimidine?
The IUPAC name of 6-methyl-2,4-diphenyl-1,4-dihydropyrimidine (CID 5251039) is 6-methyl-2,4-diphenyl-1,4-dihydropyrimidine.
What is the SMILES notation for 6-methyl-2,4-diphenyl-1,4-dihydropyrimidine?
The canonical SMILES for 6-methyl-2,4-diphenyl-1,4-dihydropyrimidine is CC1=CC(c2ccccc2)N=C(c2ccccc2)N1.
What is the InChIKey of 6-methyl-2,4-diphenyl-1,4-dihydropyrimidine?
The InChIKey is OVCSIQFHOSJUDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2/c1-13-12-16(14-8-4-2-5-9-14)19-17(18-13)15-10-6-3-7-11-15/h2-12,16H,1H3,(H,18,19).
What are the key properties of 6-methyl-2,4-diphenyl-1,4-dihydropyrimidine?
6-methyl-2,4-diphenyl-1,4-dihydropyrimidine has a molecular weight of 248.33 g/mol, XLogP of 3.68, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2,4-diphenyl-1,4-dihydropyrimidine is sourced from PubChem (CID 5251039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).