C18H20O8 — CID 5251115
tetramethyl 1,5-dimethyltricyclo[3.3.0.02,8]octa-3,6-diene-2,4,6,8-tetracarboxylate (PubChem CID 5251115) has the molecular formula C18H20O8 and a molecular weight of 364.35 g/mol. Its IUPAC name is tetramethyl 1,5-dimethyltricyclo[3.3.0.02,8]octa-3,6-diene-2,4,6,8-tetracarboxylate.
| Compound Name | tetramethyl 1,5-dimethyltricyclo[3.3.0.02,8]octa-3,6-diene-2,4,6,8-tetracarboxylate |
|---|---|
| PubChem CID | 5251115 |
| Molecular Formula | C18H20O8 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | tetramethyl 1,5-dimethyltricyclo[3.3.0.02,8]octa-3,6-diene-2,4,6,8-tetracarboxylate |
| SMILES | COC(=O)C1=CC2(C(=O)OC)C3(C(=O)OC)C=C(C(=O)OC)C1(C)C23C |
| InChI | InChI=1S/C18H20O8/c1-15-9(11(19)23-3)7-17(13(21)25-5)16(15,2)18(17,14(22)26-6)8-10(15)12(20)24-4/h7-8H,1-6H3 |
| InChIKey | ZLWFJGUNAKPCMZ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|