C21H28N2O3 — CID 52511200
2-[(1S)-cyclopent-2-en-1-yl]-N-[[4-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]phenyl]methyl]acetamide (PubChem CID 52511200) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is 2-[(1S)-cyclopent-2-en-1-yl]-N-[[4-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]phenyl]methyl]acetamide.
| Compound Name | 2-[(1S)-cyclopent-2-en-1-yl]-N-[[4-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 52511200 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 2-[(1S)-cyclopent-2-en-1-yl]-N-[[4-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]phenyl]methyl]acetamide |
| SMILES | C[C@@H]1CN(C(=O)c2ccc(CNC(=O)C[C@H]3C=CCC3)cc2)C[C@@H](C)O1 |
| InChI | InChI=1S/C21H28N2O3/c1-15-13-23(14-16(2)26-15)21(25)19-9-7-18(8-10-19)12-22-20(24)11-17-5-3-4-6-17/h3,5,7-10,15-17H,4,6,11-14H2,1-2H3,(H,22,24)/t15-,16-,17+/m1/s1 |
| InChIKey | RVJMRCLEQTYUIO-ZACQAIPSSA-N |
| XLogP | 2.91 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|