C20H23N3O4 — CID 52512606
2-[(4S)-4-(2,5-dimethylfuran-3-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2,6-dimethylphenyl)acetamide (PubChem CID 52512606) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 2-[(4S)-4-(2,5-dimethylfuran-3-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2,6-dimethylphenyl)acetamide.
| Compound Name | 2-[(4S)-4-(2,5-dimethylfuran-3-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 52512606 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 2-[(4S)-4-(2,5-dimethylfuran-3-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2,6-dimethylphenyl)acetamide |
| SMILES | Cc1cc([C@]2(C)NC(=O)N(CC(=O)Nc3c(C)cccc3C)C2=O)c(C)o1 |
| InChI | InChI=1S/C20H23N3O4/c1-11-7-6-8-12(2)17(11)21-16(24)10-23-18(25)20(5,22-19(23)26)15-9-13(3)27-14(15)4/h6-9H,10H2,1-5H3,(H,21,24)(H,22,26)/t20-/m0/s1 |
| InChIKey | ZYQKQMCDPAJQSC-FQEVSTJZSA-N |
| XLogP | 2.92 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|