About (2R)-1'-benzyl-3-(2-methoxyethyl)spiro[1H-quinazoline-2,3'-indole]-2',4-dione
(2R)-1'-benzyl-3-(2-methoxyethyl)spiro[1H-quinazoline-2,3'-indole]-2',4-dione (PubChem CID 52512911) has the molecular formula C25H23N3O3
and a molecular weight of 413.48 g/mol. Its IUPAC name is (2R)-1'-benzyl-3-(2-methoxyethyl)spiro[1H-quinazoline-2,3'-indole]-2',4-dione.
Molecular Properties
| Compound Name | (2R)-1'-benzyl-3-(2-methoxyethyl)spiro[1H-quinazoline-2,3'-indole]-2',4-dione |
| PubChem CID | 52512911 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | (2R)-1'-benzyl-3-(2-methoxyethyl)spiro[1H-quinazoline-2,3'-indole]-2',4-dione |
| SMILES | COCCN1C(=O)c2ccccc2N[C@@]12C(=O)N(Cc1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C25H23N3O3/c1-31-16-15-28-23(29)19-11-5-7-13-21(19)26-25(28)20-12-6-8-14-22(20)27(24(25)30)17-18-9-3-2-4-10-18/h2-14,26H,15-17H2,1H3/t25-/m1/s1 |
| InChIKey | ZOAGHAHCUFRUAI-RUZDIDTESA-N |
| XLogP | 3.60 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-1'-benzyl-3-(2-methoxyethyl)spiro[1H-quinazoline-2,3'-indole]-2',4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1'-benzyl-3-(2-methoxyethyl)spiro[1H-quinazoline-2,3'-indole]-2',4-dione?
The IUPAC name of (2R)-1'-benzyl-3-(2-methoxyethyl)spiro[1H-quinazoline-2,3'-indole]-2',4-dione (CID 52512911) is (2R)-1'-benzyl-3-(2-methoxyethyl)spiro[1H-quinazoline-2,3'-indole]-2',4-dione.
What is the SMILES notation for (2R)-1'-benzyl-3-(2-methoxyethyl)spiro[1H-quinazoline-2,3'-indole]-2',4-dione?
The canonical SMILES for (2R)-1'-benzyl-3-(2-methoxyethyl)spiro[1H-quinazoline-2,3'-indole]-2',4-dione is COCCN1C(=O)c2ccccc2N[C@@]12C(=O)N(Cc1ccccc1)c1ccccc12.
What is the InChIKey of (2R)-1'-benzyl-3-(2-methoxyethyl)spiro[1H-quinazoline-2,3'-indole]-2',4-dione?
The InChIKey is ZOAGHAHCUFRUAI-RUZDIDTESA-N. The full InChI is InChI=1S/C25H23N3O3/c1-31-16-15-28-23(29)19-11-5-7-13-21(19)26-25(28)20-12-6-8-14-22(20)27(24(25)30)17-18-9-3-2-4-10-18/h2-14,26H,15-17H2,1H3/t25-/m1/s1.
What are the key properties of (2R)-1'-benzyl-3-(2-methoxyethyl)spiro[1H-quinazoline-2,3'-indole]-2',4-dione?
(2R)-1'-benzyl-3-(2-methoxyethyl)spiro[1H-quinazoline-2,3'-indole]-2',4-dione has a molecular weight of 413.48 g/mol, XLogP of 3.60, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1'-benzyl-3-(2-methoxyethyl)spiro[1H-quinazoline-2,3'-indole]-2',4-dione is sourced from PubChem (CID 52512911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).