C18H18N2OS — CID 52513236
(3-methyl-1-benzothiophen-2-yl)-[(2R)-2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]methanone (PubChem CID 52513236) has the molecular formula C18H18N2OS and a molecular weight of 310.42 g/mol. Its IUPAC name is (3-methyl-1-benzothiophen-2-yl)-[(2R)-2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]methanone.
| Compound Name | (3-methyl-1-benzothiophen-2-yl)-[(2R)-2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 52513236 |
| Molecular Formula | C18H18N2OS |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | (3-methyl-1-benzothiophen-2-yl)-[(2R)-2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]methanone |
| SMILES | Cc1c(C(=O)N2CCC[C@@H]2c2ccc[nH]2)sc2ccccc12 |
| InChI | InChI=1S/C18H18N2OS/c1-12-13-6-2-3-9-16(13)22-17(12)18(21)20-11-5-8-15(20)14-7-4-10-19-14/h2-4,6-7,9-10,15,19H,5,8,11H2,1H3/t15-/m1/s1 |
| InChIKey | OJZCSBIJXKRWDW-OAHLLOKOSA-N |
| XLogP | 4.52 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |