C20H25N3O3 — CID 52513385
2-(2-methyl-1H-indol-3-yl)-N-[3-[(3R)-3-methylpiperidin-1-yl]-3-oxopropyl]-2-oxoacetamide (PubChem CID 52513385) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is 2-(2-methyl-1H-indol-3-yl)-N-[3-[(3R)-3-methylpiperidin-1-yl]-3-oxopropyl]-2-oxoacetamide.
| Compound Name | 2-(2-methyl-1H-indol-3-yl)-N-[3-[(3R)-3-methylpiperidin-1-yl]-3-oxopropyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 52513385 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 2-(2-methyl-1H-indol-3-yl)-N-[3-[(3R)-3-methylpiperidin-1-yl]-3-oxopropyl]-2-oxoacetamide |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)C(=O)NCCC(=O)N1CCC[C@@H](C)C1 |
| InChI | InChI=1S/C20H25N3O3/c1-13-6-5-11-23(12-13)17(24)9-10-21-20(26)19(25)18-14(2)22-16-8-4-3-7-15(16)18/h3-4,7-8,13,22H,5-6,9-12H2,1-2H3,(H,21,26)/t13-/m1/s1 |
| InChIKey | DNEBEFYWJLSANR-CYBMUJFWSA-N |
| XLogP | 2.42 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|