C22H24F3N3O2 — CID 52513508
1-(4-methylphenyl)-3-[[(3R)-1-[4-(trifluoromethyl)benzoyl]piperidin-3-yl]methyl]urea (PubChem CID 52513508) has the molecular formula C22H24F3N3O2 and a molecular weight of 419.45 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-[[(3R)-1-[4-(trifluoromethyl)benzoyl]piperidin-3-yl]methyl]urea.
| Compound Name | 1-(4-methylphenyl)-3-[[(3R)-1-[4-(trifluoromethyl)benzoyl]piperidin-3-yl]methyl]urea |
|---|---|
| PubChem CID | 52513508 |
| Molecular Formula | C22H24F3N3O2 |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 1-(4-methylphenyl)-3-[[(3R)-1-[4-(trifluoromethyl)benzoyl]piperidin-3-yl]methyl]urea |
| SMILES | Cc1ccc(NC(=O)NC[C@H]2CCCN(C(=O)c3ccc(C(F)(F)F)cc3)C2)cc1 |
| InChI | InChI=1S/C22H24F3N3O2/c1-15-4-10-19(11-5-15)27-21(30)26-13-16-3-2-12-28(14-16)20(29)17-6-8-18(9-7-17)22(23,24)25/h4-11,16H,2-3,12-14H2,1H3,(H2,26,27,30)/t16-/m1/s1 |
| InChIKey | IPUIHQCHYPASRO-MRXNPFEDSA-N |
| XLogP | 4.69 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |