C16H19BrN4O2 — CID 52516717
(2S)-2-(3-bromophenyl)-N-[(1-methylpyrazol-4-yl)methyl]morpholine-4-carboxamide (PubChem CID 52516717) has the molecular formula C16H19BrN4O2 and a molecular weight of 379.26 g/mol. Its IUPAC name is (2S)-2-(3-bromophenyl)-N-[(1-methylpyrazol-4-yl)methyl]morpholine-4-carboxamide.
| Compound Name | (2S)-2-(3-bromophenyl)-N-[(1-methylpyrazol-4-yl)methyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 52516717 |
| Molecular Formula | C16H19BrN4O2 |
| Molecular Weight | 379.26 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | (2S)-2-(3-bromophenyl)-N-[(1-methylpyrazol-4-yl)methyl]morpholine-4-carboxamide |
| SMILES | Cn1cc(CNC(=O)N2CCO[C@@H](c3cccc(Br)c3)C2)cn1 |
| InChI | InChI=1S/C16H19BrN4O2/c1-20-10-12(9-19-20)8-18-16(22)21-5-6-23-15(11-21)13-3-2-4-14(17)7-13/h2-4,7,9-10,15H,5-6,8,11H2,1H3,(H,18,22)/t15-/m1/s1 |
| InChIKey | TUWUTRQRPOKWBU-OAHLLOKOSA-N |
| XLogP | 2.47 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.26 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |