C7H13N — CID 5251736
2,6-dimethyl-1,2,3,6-tetrahydropyridine (PubChem CID 5251736) has the molecular formula C7H13N and a molecular weight of 111.19 g/mol. Its IUPAC name is 2,6-dimethyl-1,2,3,6-tetrahydropyridine.
| Compound Name | 2,6-dimethyl-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 5251736 |
| Molecular Formula | C7H13N |
| Molecular Weight | 111.19 g/mol |
| Exact Mass | 111.10 |
| IUPAC Name | 2,6-dimethyl-1,2,3,6-tetrahydropyridine |
| SMILES | CC1C=CCC(C)N1 |
| InChI | InChI=1S/C7H13N/c1-6-4-3-5-7(2)8-6/h3-4,6-8H,5H2,1-2H3 |
| InChIKey | BYKSINWBBKKRQC-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 111.19 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|