About 2-pyrazol-1-yl-1,2,3,6-tetrahydropyridine
2-pyrazol-1-yl-1,2,3,6-tetrahydropyridine (PubChem CID 5252317) has the molecular formula C8H11N3
and a molecular weight of 149.20 g/mol. Its IUPAC name is 2-pyrazol-1-yl-1,2,3,6-tetrahydropyridine.
Molecular Properties
| Compound Name | 2-pyrazol-1-yl-1,2,3,6-tetrahydropyridine |
| PubChem CID | 5252317 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 2-pyrazol-1-yl-1,2,3,6-tetrahydropyridine |
| SMILES | C1=CCC(n2cccn2)NC1 |
| InChI | InChI=1S/C8H11N3/c1-2-5-9-8(4-1)11-7-3-6-10-11/h1-3,6-9H,4-5H2 |
| InChIKey | LYRBLVLMGFMBPG-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-pyrazol-1-yl-1,2,3,6-tetrahydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrazol-1-yl-1,2,3,6-tetrahydropyridine?
The IUPAC name of 2-pyrazol-1-yl-1,2,3,6-tetrahydropyridine (CID 5252317) is 2-pyrazol-1-yl-1,2,3,6-tetrahydropyridine.
What is the SMILES notation for 2-pyrazol-1-yl-1,2,3,6-tetrahydropyridine?
The canonical SMILES for 2-pyrazol-1-yl-1,2,3,6-tetrahydropyridine is C1=CCC(n2cccn2)NC1.
What is the InChIKey of 2-pyrazol-1-yl-1,2,3,6-tetrahydropyridine?
The InChIKey is LYRBLVLMGFMBPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3/c1-2-5-9-8(4-1)11-7-3-6-10-11/h1-3,6-9H,4-5H2.
What are the key properties of 2-pyrazol-1-yl-1,2,3,6-tetrahydropyridine?
2-pyrazol-1-yl-1,2,3,6-tetrahydropyridine has a molecular weight of 149.20 g/mol, XLogP of 0.93, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrazol-1-yl-1,2,3,6-tetrahydropyridine is sourced from PubChem (CID 5252317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).