C36H42O4 — CID 5252441
dimethyl 5-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-1,6-dimethyl-9-propan-2-yltricyclo[5.4.1.04,12]dodeca-2,6,8,10-tetraene-2,3-dicarboxylate (PubChem CID 5252441) has the molecular formula C36H42O4 and a molecular weight of 538.73 g/mol. Its IUPAC name is dimethyl 5-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-1,6-dimethyl-9-propan-2-yltricyclo[5.4.1.04,12]dodeca-2,6,8,10-tetraene-2,3-dicarboxylate.
| Compound Name | dimethyl 5-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-1,6-dimethyl-9-propan-2-yltricyclo[5.4.1.04,12]dodeca-2,6,8,10-tetraene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 5252441 |
| Molecular Formula | C36H42O4 |
| Molecular Weight | 538.73 g/mol |
| Exact Mass | 538.31 |
| IUPAC Name | dimethyl 5-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-1,6-dimethyl-9-propan-2-yltricyclo[5.4.1.04,12]dodeca-2,6,8,10-tetraene-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(C)C=CC(C(C)C)=CC3=C(C)C(c4cc(C)c5cc(C(C)C)ccc(C)c4-5)C1C32 |
| InChI | InChI=1S/C36H42O4/c1-18(2)23-12-11-20(5)28-25(16-23)21(6)15-27(28)29-22(7)26-17-24(19(3)4)13-14-36(8)32(26)30(29)31(34(37)39-9)33(36)35(38)40-10/h11-19,29-30,32H,1-10H3 |
| InChIKey | HCSWETFLULBICQ-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.73 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |