C25H29N7OS — CID 52524714
N-[(R)-(5-methyl-1H-1,2,4-triazol-3-yl)-phenylmethyl]-2-(morpholin-4-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 52524714) has the molecular formula C25H29N7OS and a molecular weight of 475.62 g/mol. Its IUPAC name is N-[(R)-(5-methyl-1H-1,2,4-triazol-3-yl)-phenylmethyl]-2-(morpholin-4-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(R)-(5-methyl-1H-1,2,4-triazol-3-yl)-phenylmethyl]-2-(morpholin-4-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 52524714 |
| Molecular Formula | C25H29N7OS |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | N-[(R)-(5-methyl-1H-1,2,4-triazol-3-yl)-phenylmethyl]-2-(morpholin-4-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1nc([C@H](Nc2nc(CN3CCOCC3)nc3sc4c(c23)CCCC4)c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C25H29N7OS/c1-16-26-24(31-30-16)22(17-7-3-2-4-8-17)29-23-21-18-9-5-6-10-19(18)34-25(21)28-20(27-23)15-32-11-13-33-14-12-32/h2-4,7-8,22H,5-6,9-15H2,1H3,(H,26,30,31)(H,27,28,29)/t22-/m1/s1 |
| InChIKey | LGAQQFAERHYQEU-JOCHJYFZSA-N |
| XLogP | 4.03 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |