C14H13BrN4O3S — CID 52525343
(7S)-7-(5-bromo-2-hydroxy-3-methoxyphenyl)-2-methylsulfanyl-7,8-dihydro-6H-pyrimido[4,5-d]pyrimidin-5-one (PubChem CID 52525343) has the molecular formula C14H13BrN4O3S and a molecular weight of 397.25 g/mol. Its IUPAC name is (7S)-7-(5-bromo-2-hydroxy-3-methoxyphenyl)-2-methylsulfanyl-7,8-dihydro-6H-pyrimido[4,5-d]pyrimidin-5-one.
| Compound Name | (7S)-7-(5-bromo-2-hydroxy-3-methoxyphenyl)-2-methylsulfanyl-7,8-dihydro-6H-pyrimido[4,5-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 52525343 |
| Molecular Formula | C14H13BrN4O3S |
| Molecular Weight | 397.25 g/mol |
| Exact Mass | 395.99 |
| IUPAC Name | (7S)-7-(5-bromo-2-hydroxy-3-methoxyphenyl)-2-methylsulfanyl-7,8-dihydro-6H-pyrimido[4,5-d]pyrimidin-5-one |
| SMILES | COc1cc(Br)cc([C@@H]2NC(=O)c3cnc(SC)nc3N2)c1O |
| InChI | InChI=1S/C14H13BrN4O3S/c1-22-9-4-6(15)3-7(10(9)20)11-17-12-8(13(21)18-11)5-16-14(19-12)23-2/h3-5,11,20H,1-2H3,(H,18,21)(H,16,17,19)/t11-/m0/s1 |
| InChIKey | GBUOJGYVLBXWKN-NSHDSACASA-N |
| XLogP | 2.53 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|