About 2-benzyl-1,1,3,3-tetramethylguanidine
2-benzyl-1,1,3,3-tetramethylguanidine (PubChem CID 525254) has the molecular formula C12H19N3
and a molecular weight of 205.31 g/mol. Its IUPAC name is 2-benzyl-1,1,3,3-tetramethylguanidine.
Molecular Properties
| Compound Name | 2-benzyl-1,1,3,3-tetramethylguanidine |
| PubChem CID | 525254 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 2-benzyl-1,1,3,3-tetramethylguanidine |
| SMILES | CN(C)C(=NCc1ccccc1)N(C)C |
| InChI | InChI=1S/C12H19N3/c1-14(2)12(15(3)4)13-10-11-8-6-5-7-9-11/h5-9H,10H2,1-4H3 |
| InChIKey | ZHCQWGTUGHXYFA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-1,1,3,3-tetramethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-1,1,3,3-tetramethylguanidine?
The IUPAC name of 2-benzyl-1,1,3,3-tetramethylguanidine (CID 525254) is 2-benzyl-1,1,3,3-tetramethylguanidine.
What is the SMILES notation for 2-benzyl-1,1,3,3-tetramethylguanidine?
The canonical SMILES for 2-benzyl-1,1,3,3-tetramethylguanidine is CN(C)C(=NCc1ccccc1)N(C)C.
What is the InChIKey of 2-benzyl-1,1,3,3-tetramethylguanidine?
The InChIKey is ZHCQWGTUGHXYFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3/c1-14(2)12(15(3)4)13-10-11-8-6-5-7-9-11/h5-9H,10H2,1-4H3.
What are the key properties of 2-benzyl-1,1,3,3-tetramethylguanidine?
2-benzyl-1,1,3,3-tetramethylguanidine has a molecular weight of 205.31 g/mol, XLogP of 1.67, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-1,1,3,3-tetramethylguanidine is sourced from PubChem (CID 525254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).