C56H72O4 — CID 5252545
5,11,17,23-tetratert-butyl-25,26,27,28-tetrakis(prop-2-enoxy)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene (PubChem CID 5252545) has the molecular formula C56H72O4 and a molecular weight of 809.19 g/mol. Its IUPAC name is 5,11,17,23-tetratert-butyl-25,26,27,28-tetrakis(prop-2-enoxy)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene.
| Compound Name | 5,11,17,23-tetratert-butyl-25,26,27,28-tetrakis(prop-2-enoxy)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene |
|---|---|
| PubChem CID | 5252545 |
| Molecular Formula | C56H72O4 |
| Molecular Weight | 809.19 g/mol |
| Exact Mass | 808.54 |
| IUPAC Name | 5,11,17,23-tetratert-butyl-25,26,27,28-tetrakis(prop-2-enoxy)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene |
| SMILES | C=CCOc1c2cc(C(C)(C)C)cc1Cc1cc(C(C)(C)C)cc(c1OCC=C)Cc1cc(C(C)(C)C)cc(c1OCC=C)Cc1cc(C(C)(C)C)cc(c1OCC=C)C2 |
| InChI | InChI=1S/C56H72O4/c1-17-21-57-49-37-25-39-31-46(54(8,9)10)33-41(50(39)58-22-18-2)27-43-35-48(56(14,15)16)36-44(52(43)60-24-20-4)28-42-34-47(55(11,12)13)32-40(51(42)59-23-19-3)26-38(49)30-45(29-37)53(5,6)7/h17-20,29-36H,1-4,21-28H2,5-16H3 |
| InChIKey | SIVAJLXFQCCNRP-UHFFFAOYSA-N |
| XLogP | 13.81 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.19 |
| LogP ≤ 5 | 13.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|