C10H9N3O4 — CID 5252616
8-nitro-1,3,4,6-tetrahydro-1,6-benzodiazocine-2,5-dione (PubChem CID 5252616) has the molecular formula C10H9N3O4 and a molecular weight of 235.20 g/mol. Its IUPAC name is 8-nitro-1,3,4,6-tetrahydro-1,6-benzodiazocine-2,5-dione.
| Compound Name | 8-nitro-1,3,4,6-tetrahydro-1,6-benzodiazocine-2,5-dione |
|---|---|
| PubChem CID | 5252616 |
| Molecular Formula | C10H9N3O4 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 8-nitro-1,3,4,6-tetrahydro-1,6-benzodiazocine-2,5-dione |
| SMILES | O=C1CCC(=O)Nc2cc([N+](=O)[O-])ccc2N1 |
| InChI | InChI=1S/C10H9N3O4/c14-9-3-4-10(15)12-8-5-6(13(16)17)1-2-7(8)11-9/h1-2,5H,3-4H2,(H,11,14)(H,12,15) |
| InChIKey | GHBYRPLNYXMUMG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|