C21H14F2N2OS — CID 52527187
2-[bis(4-fluorophenyl)methylsulfanyl]-5-phenyl-1,3,4-oxadiazole (PubChem CID 52527187) has the molecular formula C21H14F2N2OS and a molecular weight of 380.42 g/mol. Its IUPAC name is 2-[bis(4-fluorophenyl)methylsulfanyl]-5-phenyl-1,3,4-oxadiazole.
| Compound Name | 2-[bis(4-fluorophenyl)methylsulfanyl]-5-phenyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 52527187 |
| Molecular Formula | C21H14F2N2OS |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 2-[bis(4-fluorophenyl)methylsulfanyl]-5-phenyl-1,3,4-oxadiazole |
| SMILES | Fc1ccc(C(Sc2nnc(-c3ccccc3)o2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H14F2N2OS/c22-17-10-6-14(7-11-17)19(15-8-12-18(23)13-9-15)27-21-25-24-20(26-21)16-4-2-1-3-5-16/h1-13,19H |
| InChIKey | CGIZOXXPNVUGRL-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |