About N'-hexyl-N,N-dimethylethanimidamide
N'-hexyl-N,N-dimethylethanimidamide (PubChem CID 525280) has the molecular formula C10H22N2
and a molecular weight of 170.30 g/mol. Its IUPAC name is N'-hexyl-N,N-dimethylethanimidamide.
Molecular Properties
| Compound Name | N'-hexyl-N,N-dimethylethanimidamide |
| PubChem CID | 525280 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | N'-hexyl-N,N-dimethylethanimidamide |
| SMILES | CCCCCC/N=C(\C)N(C)C |
| InChI | InChI=1S/C10H22N2/c1-5-6-7-8-9-11-10(2)12(3)4/h5-9H2,1-4H3/b11-10+ |
| InChIKey | BWEYLJQZCIDMME-ZHACJKMWSA-N |
| XLogP | 2.55 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-hexyl-N,N-dimethylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hexyl-N,N-dimethylethanimidamide?
The IUPAC name of N'-hexyl-N,N-dimethylethanimidamide (CID 525280) is N'-hexyl-N,N-dimethylethanimidamide.
What is the SMILES notation for N'-hexyl-N,N-dimethylethanimidamide?
The canonical SMILES for N'-hexyl-N,N-dimethylethanimidamide is CCCCCC/N=C(\C)N(C)C.
What is the InChIKey of N'-hexyl-N,N-dimethylethanimidamide?
The InChIKey is BWEYLJQZCIDMME-ZHACJKMWSA-N. The full InChI is InChI=1S/C10H22N2/c1-5-6-7-8-9-11-10(2)12(3)4/h5-9H2,1-4H3/b11-10+.
What are the key properties of N'-hexyl-N,N-dimethylethanimidamide?
N'-hexyl-N,N-dimethylethanimidamide has a molecular weight of 170.30 g/mol, XLogP of 2.55, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hexyl-N,N-dimethylethanimidamide is sourced from PubChem (CID 525280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).