About 4-chloro-N-[1-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide
4-chloro-N-[1-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide (PubChem CID 5252986) has the molecular formula C11H9ClF3N3O4S
and a molecular weight of 371.72 g/mol. Its IUPAC name is 4-chloro-N-[1-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-chloro-N-[1-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide |
| PubChem CID | 5252986 |
| Molecular Formula | C11H9ClF3N3O4S |
| Molecular Weight | 371.72 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | 4-chloro-N-[1-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide |
| SMILES | CN1C(=O)NC(NS(=O)(=O)c2ccc(Cl)cc2)(C(F)(F)F)C1=O |
| InChI | InChI=1S/C11H9ClF3N3O4S/c1-18-8(19)10(11(13,14)15,16-9(18)20)17-23(21,22)7-4-2-6(12)3-5-7/h2-5,17H,1H3,(H,16,20) |
| InChIKey | PYWZFXXNUSYXTC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.72 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-N-[1-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[1-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide?
The IUPAC name of 4-chloro-N-[1-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide (CID 5252986) is 4-chloro-N-[1-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide.
What is the SMILES notation for 4-chloro-N-[1-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide?
The canonical SMILES for 4-chloro-N-[1-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide is CN1C(=O)NC(NS(=O)(=O)c2ccc(Cl)cc2)(C(F)(F)F)C1=O.
What is the InChIKey of 4-chloro-N-[1-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide?
The InChIKey is PYWZFXXNUSYXTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClF3N3O4S/c1-18-8(19)10(11(13,14)15,16-9(18)20)17-23(21,22)7-4-2-6(12)3-5-7/h2-5,17H,1H3,(H,16,20).
What are the key properties of 4-chloro-N-[1-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide?
4-chloro-N-[1-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide has a molecular weight of 371.72 g/mol, XLogP of 1.06, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[1-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide is sourced from PubChem (CID 5252986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).