C11H24N4O — CID 52532885
2-methyl-1-[(2S)-3-methyl-2-morpholin-4-ylbutyl]guanidine (PubChem CID 52532885) has the molecular formula C11H24N4O and a molecular weight of 228.34 g/mol. Its IUPAC name is 2-methyl-1-[(2S)-3-methyl-2-morpholin-4-ylbutyl]guanidine.
| Compound Name | 2-methyl-1-[(2S)-3-methyl-2-morpholin-4-ylbutyl]guanidine |
|---|---|
| PubChem CID | 52532885 |
| Molecular Formula | C11H24N4O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.20 |
| IUPAC Name | 2-methyl-1-[(2S)-3-methyl-2-morpholin-4-ylbutyl]guanidine |
| SMILES | C/N=C(\N)NC[C@H](C(C)C)N1CCOCC1 |
| InChI | InChI=1S/C11H24N4O/c1-9(2)10(8-14-11(12)13-3)15-4-6-16-7-5-15/h9-10H,4-8H2,1-3H3,(H3,12,13,14)/t10-/m1/s1 |
| InChIKey | SBTXAWBETYHFOV-SNVBAGLBSA-N |
| XLogP | -0.12 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|