C18H19N5O3 — CID 5253483
2-(3,4-dimethoxyphenyl)-5-(3-imidazol-1-ylpropylamino)-1,3-oxazole-4-carbonitrile (PubChem CID 5253483) has the molecular formula C18H19N5O3 and a molecular weight of 353.38 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5-(3-imidazol-1-ylpropylamino)-1,3-oxazole-4-carbonitrile.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5-(3-imidazol-1-ylpropylamino)-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 5253483 |
| Molecular Formula | C18H19N5O3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5-(3-imidazol-1-ylpropylamino)-1,3-oxazole-4-carbonitrile |
| SMILES | COc1ccc(-c2nc(C#N)c(NCCCn3ccnc3)o2)cc1OC |
| InChI | InChI=1S/C18H19N5O3/c1-24-15-5-4-13(10-16(15)25-2)17-22-14(11-19)18(26-17)21-6-3-8-23-9-7-20-12-23/h4-5,7,9-10,12,21H,3,6,8H2,1-2H3 |
| InChIKey | RAAAMPCMYOBGGM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|