C20H21ClO4S — CID 52534867
6-chloro-8-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfonylmethyl]-3,4-dihydro-2H-1,5-benzodioxepine (PubChem CID 52534867) has the molecular formula C20H21ClO4S and a molecular weight of 392.90 g/mol. Its IUPAC name is 6-chloro-8-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfonylmethyl]-3,4-dihydro-2H-1,5-benzodioxepine.
| Compound Name | 6-chloro-8-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfonylmethyl]-3,4-dihydro-2H-1,5-benzodioxepine |
|---|---|
| PubChem CID | 52534867 |
| Molecular Formula | C20H21ClO4S |
| Molecular Weight | 392.90 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 6-chloro-8-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfonylmethyl]-3,4-dihydro-2H-1,5-benzodioxepine |
| SMILES | O=S(=O)(Cc1cc(Cl)c2c(c1)OCCCO2)[C@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C20H21ClO4S/c21-17-11-14(12-18-20(17)25-10-4-9-24-18)13-26(22,23)19-8-3-6-15-5-1-2-7-16(15)19/h1-2,5,7,11-12,19H,3-4,6,8-10,13H2/t19-/m0/s1 |
| InChIKey | IKXYXMFXVUXFPI-IBGZPJMESA-N |
| XLogP | 4.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.90 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |