C21H25NO2 — CID 52535085
N-[(1R)-1-cyclopropylethyl]-N-(4-methoxyphenyl)-3,4-dimethylbenzamide (PubChem CID 52535085) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is N-[(1R)-1-cyclopropylethyl]-N-(4-methoxyphenyl)-3,4-dimethylbenzamide.
| Compound Name | N-[(1R)-1-cyclopropylethyl]-N-(4-methoxyphenyl)-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 52535085 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | N-[(1R)-1-cyclopropylethyl]-N-(4-methoxyphenyl)-3,4-dimethylbenzamide |
| SMILES | COc1ccc(N(C(=O)c2ccc(C)c(C)c2)[C@H](C)C2CC2)cc1 |
| InChI | InChI=1S/C21H25NO2/c1-14-5-6-18(13-15(14)2)21(23)22(16(3)17-7-8-17)19-9-11-20(24-4)12-10-19/h5-6,9-13,16-17H,7-8H2,1-4H3/t16-/m1/s1 |
| InChIKey | KEFOCRBITVFSDX-MRXNPFEDSA-N |
| XLogP | 4.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |