C16H10ClF4N3OS — CID 5253513
4-(3-chlorophenyl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1H-1,2,4-triazole-5-thione (PubChem CID 5253513) has the molecular formula C16H10ClF4N3OS and a molecular weight of 403.79 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(3-chlorophenyl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 5253513 |
| Molecular Formula | C16H10ClF4N3OS |
| Molecular Weight | 403.79 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | 4-(3-chlorophenyl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1H-1,2,4-triazole-5-thione |
| SMILES | FC(F)C(F)(F)Oc1cccc(-c2n[nH]c(=S)n2-c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C16H10ClF4N3OS/c17-10-4-2-5-11(8-10)24-13(22-23-15(24)26)9-3-1-6-12(7-9)25-16(20,21)14(18)19/h1-8,14H,(H,23,26) |
| InChIKey | ALZCJFWOTHEAFH-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.79 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|