C27H32N4O2S — CID 5253534
4-[2-(3,4-diethoxyphenyl)ethyl]-3-(1,2,3,4-tetrahydrocarbazol-9-ylmethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 5253534) has the molecular formula C27H32N4O2S and a molecular weight of 476.65 g/mol. Its IUPAC name is 4-[2-(3,4-diethoxyphenyl)ethyl]-3-(1,2,3,4-tetrahydrocarbazol-9-ylmethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[2-(3,4-diethoxyphenyl)ethyl]-3-(1,2,3,4-tetrahydrocarbazol-9-ylmethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 5253534 |
| Molecular Formula | C27H32N4O2S |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | 4-[2-(3,4-diethoxyphenyl)ethyl]-3-(1,2,3,4-tetrahydrocarbazol-9-ylmethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCOc1ccc(CCn2c(Cn3c4c(c5ccccc53)CCCC4)n[nH]c2=S)cc1OCC |
| InChI | InChI=1S/C27H32N4O2S/c1-3-32-24-14-13-19(17-25(24)33-4-2)15-16-30-26(28-29-27(30)34)18-31-22-11-7-5-9-20(22)21-10-6-8-12-23(21)31/h5,7,9,11,13-14,17H,3-4,6,8,10,12,15-16,18H2,1-2H3,(H,29,34) |
| InChIKey | RTJJHUXGKNZLIB-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 57.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|