C18H29N3O5 — CID 52535708
(2S)-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[[(2R)-oxan-2-yl]methoxy]propanamide (PubChem CID 52535708) has the molecular formula C18H29N3O5 and a molecular weight of 367.45 g/mol. Its IUPAC name is (2S)-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[[(2R)-oxan-2-yl]methoxy]propanamide.
| Compound Name | (2S)-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[[(2R)-oxan-2-yl]methoxy]propanamide |
|---|---|
| PubChem CID | 52535708 |
| Molecular Formula | C18H29N3O5 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | (2S)-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[[(2R)-oxan-2-yl]methoxy]propanamide |
| SMILES | CC1CCC2(CC1)NC(=O)N(NC(=O)[C@H](C)OC[C@H]1CCCCO1)C2=O |
| InChI | InChI=1S/C18H29N3O5/c1-12-6-8-18(9-7-12)16(23)21(17(24)19-18)20-15(22)13(2)26-11-14-5-3-4-10-25-14/h12-14H,3-11H2,1-2H3,(H,19,24)(H,20,22)/t12?,13-,14+,18?/m0/s1 |
| InChIKey | LYMIGEAUXGYHCC-RYTBJUFESA-N |
| XLogP | 1.49 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|