C14H19F3N2O3S — CID 52535741
(3S)-1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4,4,4-trifluoro-3-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)butan-1-one (PubChem CID 52535741) has the molecular formula C14H19F3N2O3S and a molecular weight of 352.38 g/mol. Its IUPAC name is (3S)-1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4,4,4-trifluoro-3-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)butan-1-one.
| Compound Name | (3S)-1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4,4,4-trifluoro-3-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)butan-1-one |
|---|---|
| PubChem CID | 52535741 |
| Molecular Formula | C14H19F3N2O3S |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | (3S)-1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4,4,4-trifluoro-3-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)butan-1-one |
| SMILES | Cc1csc([C@](O)(CC(=O)N2C[C@@H](C)O[C@@H](C)C2)C(F)(F)F)n1 |
| InChI | InChI=1S/C14H19F3N2O3S/c1-8-7-23-12(18-8)13(21,14(15,16)17)4-11(20)19-5-9(2)22-10(3)6-19/h7,9-10,21H,4-6H2,1-3H3/t9-,10+,13-/m1/s1 |
| InChIKey | PIEWQOBYERQTLG-GBIKHYSHSA-N |
| XLogP | 2.23 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |