C18H22N2O3 — CID 52536439
N-[(2R)-oxan-2-yl]oxy-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (PubChem CID 52536439) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is N-[(2R)-oxan-2-yl]oxy-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide.
| Compound Name | N-[(2R)-oxan-2-yl]oxy-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 52536439 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | N-[(2R)-oxan-2-yl]oxy-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| SMILES | O=C(NO[C@@H]1CCCCO1)c1ccc2[nH]c3c(c2c1)CCCC3 |
| InChI | InChI=1S/C18H22N2O3/c21-18(20-23-17-7-3-4-10-22-17)12-8-9-16-14(11-12)13-5-1-2-6-15(13)19-16/h8-9,11,17,19H,1-7,10H2,(H,20,21)/t17-/m1/s1 |
| InChIKey | OEPLGFQKHRLVRM-QGZVFWFLSA-N |
| XLogP | 3.23 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|