C19H26N2O5 — CID 52536494
ethyl (3S)-1-[2-[methyl-[(E)-3-(5-methylfuran-2-yl)prop-2-enoyl]amino]acetyl]piperidine-3-carboxylate (PubChem CID 52536494) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is ethyl (3S)-1-[2-[methyl-[(E)-3-(5-methylfuran-2-yl)prop-2-enoyl]amino]acetyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[2-[methyl-[(E)-3-(5-methylfuran-2-yl)prop-2-enoyl]amino]acetyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 52536494 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | ethyl (3S)-1-[2-[methyl-[(E)-3-(5-methylfuran-2-yl)prop-2-enoyl]amino]acetyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(C(=O)CN(C)C(=O)/C=C/c2ccc(C)o2)C1 |
| InChI | InChI=1S/C19H26N2O5/c1-4-25-19(24)15-6-5-11-21(12-15)18(23)13-20(3)17(22)10-9-16-8-7-14(2)26-16/h7-10,15H,4-6,11-13H2,1-3H3/b10-9+/t15-/m0/s1 |
| InChIKey | HLKRTWYJHLITIR-FEAKQIBJSA-N |
| XLogP | 1.86 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|