C25H30N2O2 — CID 52537504
3-[2-(4-methoxyphenyl)-1H-indol-3-yl]-1-[(4S)-4-methylazepan-1-yl]propan-1-one (PubChem CID 52537504) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 3-[2-(4-methoxyphenyl)-1H-indol-3-yl]-1-[(4S)-4-methylazepan-1-yl]propan-1-one.
| Compound Name | 3-[2-(4-methoxyphenyl)-1H-indol-3-yl]-1-[(4S)-4-methylazepan-1-yl]propan-1-one |
|---|---|
| PubChem CID | 52537504 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 3-[2-(4-methoxyphenyl)-1H-indol-3-yl]-1-[(4S)-4-methylazepan-1-yl]propan-1-one |
| SMILES | COc1ccc(-c2[nH]c3ccccc3c2CCC(=O)N2CCC[C@H](C)CC2)cc1 |
| InChI | InChI=1S/C25H30N2O2/c1-18-6-5-16-27(17-15-18)24(28)14-13-22-21-7-3-4-8-23(21)26-25(22)19-9-11-20(29-2)12-10-19/h3-4,7-12,18,26H,5-6,13-17H2,1-2H3/t18-/m0/s1 |
| InChIKey | XGWUPXSRWYRXJY-SFHVURJKSA-N |
| XLogP | 5.42 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |