About N-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide
N-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide (PubChem CID 52537596) has the molecular formula C20H17ClN2O2
and a molecular weight of 352.82 g/mol. Its IUPAC name is N-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide.
Molecular Properties
| Compound Name | N-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide |
| PubChem CID | 52537596 |
| Molecular Formula | C20H17ClN2O2 |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | N-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)C(=O)N[C@H]1CCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C20H17ClN2O2/c1-11-18(15-4-2-3-5-16(15)22-11)19(24)20(25)23-17-9-6-12-10-13(21)7-8-14(12)17/h2-5,7-8,10,17,22H,6,9H2,1H3,(H,23,25)/t17-/m0/s1 |
| InChIKey | WTXXZHVPBICKHX-KRWDZBQOSA-N |
| XLogP | 4.12 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide?
The IUPAC name of N-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide (CID 52537596) is N-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide.
What is the SMILES notation for N-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide?
The canonical SMILES for N-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide is Cc1[nH]c2ccccc2c1C(=O)C(=O)N[C@H]1CCc2cc(Cl)ccc21.
What is the InChIKey of N-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide?
The InChIKey is WTXXZHVPBICKHX-KRWDZBQOSA-N. The full InChI is InChI=1S/C20H17ClN2O2/c1-11-18(15-4-2-3-5-16(15)22-11)19(24)20(25)23-17-9-6-12-10-13(21)7-8-14(12)17/h2-5,7-8,10,17,22H,6,9H2,1H3,(H,23,25)/t17-/m0/s1.
What are the key properties of N-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide?
N-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide has a molecular weight of 352.82 g/mol, XLogP of 4.12, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide is sourced from PubChem (CID 52537596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).