C20H27N5O2 — CID 52539539
(1R)-N'-methyl-N'-(1-methylpiperidin-4-yl)-N-(3-nitro-2-pyridinyl)-1-phenylethane-1,2-diamine (PubChem CID 52539539) has the molecular formula C20H27N5O2 and a molecular weight of 369.47 g/mol. Its IUPAC name is (1R)-N'-methyl-N'-(1-methylpiperidin-4-yl)-N-(3-nitro-2-pyridinyl)-1-phenylethane-1,2-diamine.
| Compound Name | (1R)-N'-methyl-N'-(1-methylpiperidin-4-yl)-N-(3-nitro-2-pyridinyl)-1-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 52539539 |
| Molecular Formula | C20H27N5O2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | (1R)-N'-methyl-N'-(1-methylpiperidin-4-yl)-N-(3-nitro-2-pyridinyl)-1-phenylethane-1,2-diamine |
| SMILES | CN1CCC(N(C)C[C@H](Nc2ncccc2[N+](=O)[O-])c2ccccc2)CC1 |
| InChI | InChI=1S/C20H27N5O2/c1-23-13-10-17(11-14-23)24(2)15-18(16-7-4-3-5-8-16)22-20-19(25(26)27)9-6-12-21-20/h3-9,12,17-18H,10-11,13-15H2,1-2H3,(H,21,22)/t18-/m0/s1 |
| InChIKey | ZJQXIHGARKTEOR-SFHVURJKSA-N |
| XLogP | 3.17 |
| TPSA | 74.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|