C25H36N4O — CID 52543296
N-[[4-(diethylaminomethyl)phenyl]methyl]-4-(2-phenylethyl)piperazine-1-carboxamide (PubChem CID 52543296) has the molecular formula C25H36N4O and a molecular weight of 408.59 g/mol. Its IUPAC name is N-[[4-(diethylaminomethyl)phenyl]methyl]-4-(2-phenylethyl)piperazine-1-carboxamide.
| Compound Name | N-[[4-(diethylaminomethyl)phenyl]methyl]-4-(2-phenylethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 52543296 |
| Molecular Formula | C25H36N4O |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | N-[[4-(diethylaminomethyl)phenyl]methyl]-4-(2-phenylethyl)piperazine-1-carboxamide |
| SMILES | CCN(CC)Cc1ccc(CNC(=O)N2CCN(CCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C25H36N4O/c1-3-27(4-2)21-24-12-10-23(11-13-24)20-26-25(30)29-18-16-28(17-19-29)15-14-22-8-6-5-7-9-22/h5-13H,3-4,14-21H2,1-2H3,(H,26,30) |
| InChIKey | AFDZQVDOPKAZLX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |