About 2-propylsulfanylbutane
2-propylsulfanylbutane (PubChem CID 525453) has the molecular formula C7H16S
and a molecular weight of 132.27 g/mol. Its IUPAC name is 2-propylsulfanylbutane.
Molecular Properties
| Compound Name | 2-propylsulfanylbutane |
| PubChem CID | 525453 |
| Molecular Formula | C7H16S |
| Molecular Weight | 132.27 g/mol |
| Exact Mass | 132.10 |
| IUPAC Name | 2-propylsulfanylbutane |
| SMILES | CCCSC(C)CC |
| InChI | InChI=1S/C7H16S/c1-4-6-8-7(3)5-2/h7H,4-6H2,1-3H3 |
| InChIKey | ZGVPENKHDNEGTK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-propylsulfanylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylsulfanylbutane?
The IUPAC name of 2-propylsulfanylbutane (CID 525453) is 2-propylsulfanylbutane.
What is the SMILES notation for 2-propylsulfanylbutane?
The canonical SMILES for 2-propylsulfanylbutane is CCCSC(C)CC.
What is the InChIKey of 2-propylsulfanylbutane?
The InChIKey is ZGVPENKHDNEGTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16S/c1-4-6-8-7(3)5-2/h7H,4-6H2,1-3H3.
What are the key properties of 2-propylsulfanylbutane?
2-propylsulfanylbutane has a molecular weight of 132.27 g/mol, XLogP of 2.93, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylsulfanylbutane is sourced from PubChem (CID 525453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).