C20H24N2O — CID 52546187
1-(3-phenylpropyl)-3-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]urea (PubChem CID 52546187) has the molecular formula C20H24N2O and a molecular weight of 308.43 g/mol. Its IUPAC name is 1-(3-phenylpropyl)-3-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]urea.
| Compound Name | 1-(3-phenylpropyl)-3-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]urea |
|---|---|
| PubChem CID | 52546187 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 1-(3-phenylpropyl)-3-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]urea |
| SMILES | O=C(NCCCc1ccccc1)N[C@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C20H24N2O/c23-20(21-15-7-10-16-8-2-1-3-9-16)22-19-14-6-12-17-11-4-5-13-18(17)19/h1-5,8-9,11,13,19H,6-7,10,12,14-15H2,(H2,21,22,23)/t19-/m0/s1 |
| InChIKey | VRMRQMARMVNTKP-IBGZPJMESA-N |
| XLogP | 4.00 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|