C21H26N4O — CID 52546228
1-[[4-(dimethylamino)phenyl]methyl]-3-(3-indol-1-ylpropyl)urea (PubChem CID 52546228) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)phenyl]methyl]-3-(3-indol-1-ylpropyl)urea.
| Compound Name | 1-[[4-(dimethylamino)phenyl]methyl]-3-(3-indol-1-ylpropyl)urea |
|---|---|
| PubChem CID | 52546228 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 1-[[4-(dimethylamino)phenyl]methyl]-3-(3-indol-1-ylpropyl)urea |
| SMILES | CN(C)c1ccc(CNC(=O)NCCCn2ccc3ccccc32)cc1 |
| InChI | InChI=1S/C21H26N4O/c1-24(2)19-10-8-17(9-11-19)16-23-21(26)22-13-5-14-25-15-12-18-6-3-4-7-20(18)25/h3-4,6-12,15H,5,13-14,16H2,1-2H3,(H2,22,23,26) |
| InChIKey | ZZMPSZMBHIWJAI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 49.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|