C15H24O5 — CID 5254735
1,3-ditert-butyl-3,5-dihydroxy-5-methyl-7-oxabicyclo[4.1.0]heptane-2,4-dione (PubChem CID 5254735) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is 1,3-ditert-butyl-3,5-dihydroxy-5-methyl-7-oxabicyclo[4.1.0]heptane-2,4-dione.
| Compound Name | 1,3-ditert-butyl-3,5-dihydroxy-5-methyl-7-oxabicyclo[4.1.0]heptane-2,4-dione |
|---|---|
| PubChem CID | 5254735 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 1,3-ditert-butyl-3,5-dihydroxy-5-methyl-7-oxabicyclo[4.1.0]heptane-2,4-dione |
| SMILES | CC1(O)C(=O)C(O)(C(C)(C)C)C(=O)C2(C(C)(C)C)OC12 |
| InChI | InChI=1S/C15H24O5/c1-11(2,3)14(19)8(16)13(7,18)10-15(20-10,9(14)17)12(4,5)6/h10,18-19H,1-7H3 |
| InChIKey | ASQUBNIEBLZFGH-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|