C16H29N3O — CID 5254859
di(piperidin-2-yl)-(1,2,3,6-tetrahydropyridin-2-yl)methanol (PubChem CID 5254859) has the molecular formula C16H29N3O and a molecular weight of 279.43 g/mol. Its IUPAC name is di(piperidin-2-yl)-(1,2,3,6-tetrahydropyridin-2-yl)methanol.
| Compound Name | di(piperidin-2-yl)-(1,2,3,6-tetrahydropyridin-2-yl)methanol |
|---|---|
| PubChem CID | 5254859 |
| Molecular Formula | C16H29N3O |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.23 |
| IUPAC Name | di(piperidin-2-yl)-(1,2,3,6-tetrahydropyridin-2-yl)methanol |
| SMILES | OC(C1CC=CCN1)(C1CCCCN1)C1CCCCN1 |
| InChI | InChI=1S/C16H29N3O/c20-16(13-7-1-4-10-17-13,14-8-2-5-11-18-14)15-9-3-6-12-19-15/h1,4,13-15,17-20H,2-3,5-12H2 |
| InChIKey | WMDQJFAABKBYTC-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|