About dichloro(dimethyl)stannane;bis(3,5-dimethyl-1H-pyrazole)
dichloro(dimethyl)stannane;bis(3,5-dimethyl-1H-pyrazole) (PubChem CID 5255019) has the molecular formula C12H22Cl2N4Sn
and a molecular weight of 411.95 g/mol. Its IUPAC name is dichloro(dimethyl)stannane;bis(3,5-dimethyl-1H-pyrazole).
Molecular Properties
| Compound Name | dichloro(dimethyl)stannane;bis(3,5-dimethyl-1H-pyrazole) |
| PubChem CID | 5255019 |
| Molecular Formula | C12H22Cl2N4Sn |
| Molecular Weight | 411.95 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | dichloro(dimethyl)stannane;bis(3,5-dimethyl-1H-pyrazole) |
| SMILES | C[Sn](C)(Cl)Cl.Cc1cc(C)[nH]n1.Cc1cc(C)[nH]n1 |
| InChI | InChI=1S/2C5H8N2.2CH3.2ClH.Sn/c2*1-4-3-5(2)7-6-4;;;;;/h2*3H,1-2H3,(H,6,7);2*1H3;2*1H;/q;;;;;;+2/p-2 |
| InChIKey | FZZZFBNOGROQGX-UHFFFAOYSA-L |
| XLogP | 4.22 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.95 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze dichloro(dimethyl)stannane;bis(3,5-dimethyl-1H-pyrazole) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro(dimethyl)stannane;bis(3,5-dimethyl-1H-pyrazole)?
The IUPAC name of dichloro(dimethyl)stannane;bis(3,5-dimethyl-1H-pyrazole) (CID 5255019) is dichloro(dimethyl)stannane;bis(3,5-dimethyl-1H-pyrazole).
What is the SMILES notation for dichloro(dimethyl)stannane;bis(3,5-dimethyl-1H-pyrazole)?
The canonical SMILES for dichloro(dimethyl)stannane;bis(3,5-dimethyl-1H-pyrazole) is C[Sn](C)(Cl)Cl.Cc1cc(C)[nH]n1.Cc1cc(C)[nH]n1.
What is the InChIKey of dichloro(dimethyl)stannane;bis(3,5-dimethyl-1H-pyrazole)?
The InChIKey is FZZZFBNOGROQGX-UHFFFAOYSA-L. The full InChI is InChI=1S/2C5H8N2.2CH3.2ClH.Sn/c2*1-4-3-5(2)7-6-4;;;;;/h2*3H,1-2H3,(H,6,7);2*1H3;2*1H;/q;;;;;;+2/p-2.
What are the key properties of dichloro(dimethyl)stannane;bis(3,5-dimethyl-1H-pyrazole)?
dichloro(dimethyl)stannane;bis(3,5-dimethyl-1H-pyrazole) has a molecular weight of 411.95 g/mol, XLogP of 4.22, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro(dimethyl)stannane;bis(3,5-dimethyl-1H-pyrazole) is sourced from PubChem (CID 5255019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).