About 2,3-dihydroxy-2,3-dimethylbutanedioic acid
2,3-dihydroxy-2,3-dimethylbutanedioic acid (PubChem CID 5255085) has the molecular formula C6H10O6
and a molecular weight of 178.14 g/mol. Its IUPAC name is 2,3-dihydroxy-2,3-dimethylbutanedioic acid.
Molecular Properties
| Compound Name | 2,3-dihydroxy-2,3-dimethylbutanedioic acid |
| PubChem CID | 5255085 |
| Molecular Formula | C6H10O6 |
| Molecular Weight | 178.14 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | 2,3-dihydroxy-2,3-dimethylbutanedioic acid |
| SMILES | CC(O)(C(=O)O)C(C)(O)C(=O)O |
| InChI | InChI=1S/C6H10O6/c1-5(11,3(7)8)6(2,12)4(9)10/h11-12H,1-2H3,(H,7,8)(H,9,10) |
| InChIKey | CPLWWXZZFYHPJY-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.14 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-dihydroxy-2,3-dimethylbutanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxy-2,3-dimethylbutanedioic acid?
The IUPAC name of 2,3-dihydroxy-2,3-dimethylbutanedioic acid (CID 5255085) is 2,3-dihydroxy-2,3-dimethylbutanedioic acid.
What is the SMILES notation for 2,3-dihydroxy-2,3-dimethylbutanedioic acid?
The canonical SMILES for 2,3-dihydroxy-2,3-dimethylbutanedioic acid is CC(O)(C(=O)O)C(C)(O)C(=O)O.
What is the InChIKey of 2,3-dihydroxy-2,3-dimethylbutanedioic acid?
The InChIKey is CPLWWXZZFYHPJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O6/c1-5(11,3(7)8)6(2,12)4(9)10/h11-12H,1-2H3,(H,7,8)(H,9,10).
What are the key properties of 2,3-dihydroxy-2,3-dimethylbutanedioic acid?
2,3-dihydroxy-2,3-dimethylbutanedioic acid has a molecular weight of 178.14 g/mol, XLogP of -1.34, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxy-2,3-dimethylbutanedioic acid is sourced from PubChem (CID 5255085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).