C17H26O3 — CID 5255307
methyl 3a-hydroxy-3,8a-dimethyl-1-prop-1-en-2-yl-1,2,3,4,5,8-hexahydroazulene-2-carboxylate (PubChem CID 5255307) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is methyl 3a-hydroxy-3,8a-dimethyl-1-prop-1-en-2-yl-1,2,3,4,5,8-hexahydroazulene-2-carboxylate.
| Compound Name | methyl 3a-hydroxy-3,8a-dimethyl-1-prop-1-en-2-yl-1,2,3,4,5,8-hexahydroazulene-2-carboxylate |
|---|---|
| PubChem CID | 5255307 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | methyl 3a-hydroxy-3,8a-dimethyl-1-prop-1-en-2-yl-1,2,3,4,5,8-hexahydroazulene-2-carboxylate |
| SMILES | C=C(C)C1C(C(=O)OC)C(C)C2(O)CCC=CCC12C |
| InChI | InChI=1S/C17H26O3/c1-11(2)14-13(15(18)20-5)12(3)17(19)10-8-6-7-9-16(14,17)4/h6-7,12-14,19H,1,8-10H2,2-5H3 |
| InChIKey | PNSNMNPDZFADDX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|