C26H36Br2CoN2O2-2 — CID 5255322
8-[[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-id-8-yloxymethyl)cyclohexyl]methoxy]-2H-quinolin-1-ide;dibromocobalt (PubChem CID 5255322) has the molecular formula C26H36Br2CoN2O2-2 and a molecular weight of 627.33 g/mol. Its IUPAC name is 8-[[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-id-8-yloxymethyl)cyclohexyl]methoxy]-2H-quinolin-1-ide;dibromocobalt.
| Compound Name | 8-[[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-id-8-yloxymethyl)cyclohexyl]methoxy]-2H-quinolin-1-ide;dibromocobalt |
|---|---|
| PubChem CID | 5255322 |
| Molecular Formula | C26H36Br2CoN2O2-2 |
| Molecular Weight | 627.33 g/mol |
| Exact Mass | 625.05 |
| IUPAC Name | 8-[[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-id-8-yloxymethyl)cyclohexyl]methoxy]-2H-quinolin-1-ide;dibromocobalt |
| SMILES | Br[Co]Br.C1=Cc2cccc(OCC3CCCCC3COC3CCCC4CCC[N-]C43)c2[N-]C1 |
| InChI | InChI=1S/C26H36N2O2.2BrH.Co/c1-2-8-22(18-30-24-14-4-10-20-12-6-16-28-26(20)24)21(7-1)17-29-23-13-3-9-19-11-5-15-27-25(19)23;;;/h3,5,9,11,13,20-22,24,26H,1-2,4,6-8,10,12,14-18H2;2*1H;/q-2;;;+2/p-2 |
| InChIKey | RMBWDMZUBXSOEW-UHFFFAOYSA-L |
| XLogP | 8.31 |
| TPSA | 46.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.33 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |