C40H74N6 — CID 5255349
6-[1,1-bis(6-methylpiperidin-2-yl)ethyl]-2-[2-[6-[1,1-bis(6-methylpiperidin-2-yl)ethyl]piperidin-2-yl]ethyl]-1,2,3,6-tetrahydropyridine (PubChem CID 5255349) has the molecular formula C40H74N6 and a molecular weight of 639.07 g/mol. Its IUPAC name is 6-[1,1-bis(6-methylpiperidin-2-yl)ethyl]-2-[2-[6-[1,1-bis(6-methylpiperidin-2-yl)ethyl]piperidin-2-yl]ethyl]-1,2,3,6-tetrahydropyridine.
| Compound Name | 6-[1,1-bis(6-methylpiperidin-2-yl)ethyl]-2-[2-[6-[1,1-bis(6-methylpiperidin-2-yl)ethyl]piperidin-2-yl]ethyl]-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 5255349 |
| Molecular Formula | C40H74N6 |
| Molecular Weight | 639.07 g/mol |
| Exact Mass | 638.60 |
| IUPAC Name | 6-[1,1-bis(6-methylpiperidin-2-yl)ethyl]-2-[2-[6-[1,1-bis(6-methylpiperidin-2-yl)ethyl]piperidin-2-yl]ethyl]-1,2,3,6-tetrahydropyridine |
| SMILES | CC1CCCC(C(C)(C2C=CCC(CCC3CCCC(C(C)(C4CCCC(C)N4)C4CCCC(C)N4)N3)N2)C2CCCC(C)N2)N1 |
| InChI | InChI=1S/C40H74N6/c1-27-13-7-19-33(41-27)39(5,34-20-8-14-28(2)42-34)37-23-11-17-31(45-37)25-26-32-18-12-24-38(46-32)40(6,35-21-9-15-29(3)43-35)36-22-10-16-30(4)44-36/h11,23,27-38,41-46H,7-10,12-22,24-26H2,1-6H3 |
| InChIKey | OQLZKECOLDLWLH-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.07 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|