C15H21N7 — CID 5255415
2-pyrazol-1-yl-N,N-bis(2-pyrazol-1-ylethyl)ethanamine (PubChem CID 5255415) has the molecular formula C15H21N7 and a molecular weight of 299.38 g/mol. Its IUPAC name is 2-pyrazol-1-yl-N,N-bis(2-pyrazol-1-ylethyl)ethanamine.
| Compound Name | 2-pyrazol-1-yl-N,N-bis(2-pyrazol-1-ylethyl)ethanamine |
|---|---|
| PubChem CID | 5255415 |
| Molecular Formula | C15H21N7 |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 2-pyrazol-1-yl-N,N-bis(2-pyrazol-1-ylethyl)ethanamine |
| SMILES | c1cnn(CCN(CCn2cccn2)CCn2cccn2)c1 |
| InChI | InChI=1S/C15H21N7/c1-4-16-20(7-1)13-10-19(11-14-21-8-2-5-17-21)12-15-22-9-3-6-18-22/h1-9H,10-15H2 |
| InChIKey | PVRPRGVLAGBLHN-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 56.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |