C20H24N2O2 — CID 5255525
1,3,4,5,6,8,9,10-octamethyl-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodeca-4,9-diene-2,7-dicarbonitrile (PubChem CID 5255525) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 1,3,4,5,6,8,9,10-octamethyl-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodeca-4,9-diene-2,7-dicarbonitrile.
| Compound Name | 1,3,4,5,6,8,9,10-octamethyl-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodeca-4,9-diene-2,7-dicarbonitrile |
|---|---|
| PubChem CID | 5255525 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 1,3,4,5,6,8,9,10-octamethyl-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodeca-4,9-diene-2,7-dicarbonitrile |
| SMILES | CC1=C(C)C2(C)OC1(C)C1(C#N)C3(C)OC(C)(C(C)=C3C)C21C#N |
| InChI | InChI=1S/C20H24N2O2/c1-11-12(2)16(6)20(10-22)18(8)14(4)13(3)17(7,24-18)19(20,9-21)15(11,5)23-16/h1-8H3 |
| InChIKey | IICXINRHEXCBMS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|