About N-ethoxy-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide
N-ethoxy-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide (PubChem CID 52555844) has the molecular formula C7H12N2O3S
and a molecular weight of 204.25 g/mol. Its IUPAC name is N-ethoxy-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide.
Molecular Properties
| Compound Name | N-ethoxy-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide |
| PubChem CID | 52555844 |
| Molecular Formula | C7H12N2O3S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | N-ethoxy-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide |
| SMILES | CCONC(=O)CN1CSCC1=O |
| InChI | InChI=1S/C7H12N2O3S/c1-2-12-8-6(10)3-9-5-13-4-7(9)11/h2-5H2,1H3,(H,8,10) |
| InChIKey | SNJYFMGNHQQQNR-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethoxy-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethoxy-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide?
The IUPAC name of N-ethoxy-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide (CID 52555844) is N-ethoxy-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide.
What is the SMILES notation for N-ethoxy-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide?
The canonical SMILES for N-ethoxy-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide is CCONC(=O)CN1CSCC1=O.
What is the InChIKey of N-ethoxy-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide?
The InChIKey is SNJYFMGNHQQQNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O3S/c1-2-12-8-6(10)3-9-5-13-4-7(9)11/h2-5H2,1H3,(H,8,10).
What are the key properties of N-ethoxy-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide?
N-ethoxy-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide has a molecular weight of 204.25 g/mol, XLogP of -0.41, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethoxy-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide is sourced from PubChem (CID 52555844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).