About N,N-dimethylcyclohexa-1,3-dien-1-amine
N,N-dimethylcyclohexa-1,3-dien-1-amine (PubChem CID 5255616) has the molecular formula C8H13N
and a molecular weight of 123.20 g/mol. Its IUPAC name is N,N-dimethylcyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | N,N-dimethylcyclohexa-1,3-dien-1-amine |
| PubChem CID | 5255616 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | N,N-dimethylcyclohexa-1,3-dien-1-amine |
| SMILES | CN(C)C1=CC=CCC1 |
| InChI | InChI=1S/C8H13N/c1-9(2)8-6-4-3-5-7-8/h3-4,6H,5,7H2,1-2H3 |
| InChIKey | AFOFPUXNKAXNMW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dimethylcyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylcyclohexa-1,3-dien-1-amine?
The IUPAC name of N,N-dimethylcyclohexa-1,3-dien-1-amine (CID 5255616) is N,N-dimethylcyclohexa-1,3-dien-1-amine.
What is the SMILES notation for N,N-dimethylcyclohexa-1,3-dien-1-amine?
The canonical SMILES for N,N-dimethylcyclohexa-1,3-dien-1-amine is CN(C)C1=CC=CCC1.
What is the InChIKey of N,N-dimethylcyclohexa-1,3-dien-1-amine?
The InChIKey is AFOFPUXNKAXNMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N/c1-9(2)8-6-4-3-5-7-8/h3-4,6H,5,7H2,1-2H3.
What are the key properties of N,N-dimethylcyclohexa-1,3-dien-1-amine?
N,N-dimethylcyclohexa-1,3-dien-1-amine has a molecular weight of 123.20 g/mol, XLogP of 1.78, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylcyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 5255616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).