C20H10Cl6O2 — CID 5255668
5,6,8,9-tetrachloro-2-(3,4-dichlorophenyl)-3-phenyl-1-oxaspiro[3.5]nona-5,8-dien-7-one (PubChem CID 5255668) has the molecular formula C20H10Cl6O2 and a molecular weight of 495.02 g/mol. Its IUPAC name is 5,6,8,9-tetrachloro-2-(3,4-dichlorophenyl)-3-phenyl-1-oxaspiro[3.5]nona-5,8-dien-7-one.
| Compound Name | 5,6,8,9-tetrachloro-2-(3,4-dichlorophenyl)-3-phenyl-1-oxaspiro[3.5]nona-5,8-dien-7-one |
|---|---|
| PubChem CID | 5255668 |
| Molecular Formula | C20H10Cl6O2 |
| Molecular Weight | 495.02 g/mol |
| Exact Mass | 491.88 |
| IUPAC Name | 5,6,8,9-tetrachloro-2-(3,4-dichlorophenyl)-3-phenyl-1-oxaspiro[3.5]nona-5,8-dien-7-one |
| SMILES | O=C1C(Cl)=C(Cl)C2(OC(c3ccc(Cl)c(Cl)c3)C2c2ccccc2)C(Cl)=C1Cl |
| InChI | InChI=1S/C20H10Cl6O2/c21-11-7-6-10(8-12(11)22)17-13(9-4-2-1-3-5-9)20(28-17)18(25)14(23)16(27)15(24)19(20)26/h1-8,13,17H |
| InChIKey | HAFLUSGIOGQRMF-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.02 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|